C21H25N7O2S — CID 135954985
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135954985) has the molecular formula C21H25N7O2S and a molecular weight of 439.55 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135954985 |
| Molecular Formula | C21H25N7O2S |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-[2,5-dimethyl-1-(1H-1,2,4-triazol-5-yl)pyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COc1ccc(CC/N=C2/NN=C(c3cc(C)n(-c4ncn[nH]4)c3C)CS2)cc1OC |
| InChI | InChI=1S/C21H25N7O2S/c1-13-9-16(14(2)28(13)20-23-12-24-26-20)17-11-31-21(27-25-17)22-8-7-15-5-6-18(29-3)19(10-15)30-4/h5-6,9-10,12H,7-8,11H2,1-4H3,(H,22,27)(H,23,24,26) |
| InChIKey | KYGYRLDAVVIGEQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|