C16H24N2O2S — CID 136984810
N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazinan-2-imine (PubChem CID 136984810) has the molecular formula C16H24N2O2S and a molecular weight of 308.45 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazinan-2-imine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazinan-2-imine |
|---|---|
| PubChem CID | 136984810 |
| Molecular Formula | C16H24N2O2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,4-dimethyl-1,3-thiazinan-2-imine |
| SMILES | COc1ccc(CC/N=C2/NC(C)(C)CCS2)cc1OC |
| InChI | InChI=1S/C16H24N2O2S/c1-16(2)8-10-21-15(18-16)17-9-7-12-5-6-13(19-3)14(11-12)20-4/h5-6,11H,7-10H2,1-4H3,(H,17,18) |
| InChIKey | POAWJOIMUDZLFJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|