C26H26N4O3S — CID 135840296
N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]benzamide (PubChem CID 135840296) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]benzamide.
| Compound Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 135840296 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[4-[2-[2-(3,4-dimethoxyphenyl)ethylimino]-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]benzamide |
| SMILES | COc1ccc(CC/N=C2/NN=C(c3ccc(NC(=O)c4ccccc4)cc3)CS2)cc1OC |
| InChI | InChI=1S/C26H26N4O3S/c1-32-23-13-8-18(16-24(23)33-2)14-15-27-26-30-29-22(17-34-26)19-9-11-21(12-10-19)28-25(31)20-6-4-3-5-7-20/h3-13,16H,14-15,17H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | JLXPCIQGURZKRZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|