C25H30N2O4 — CID 135402306
6-[2-(3,4-dimethoxyphenyl)ethylimino]-2-hydroxy-4,4-dimethyl-N-phenylcyclohexene-1-carboxamide (PubChem CID 135402306) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 6-[2-(3,4-dimethoxyphenyl)ethylimino]-2-hydroxy-4,4-dimethyl-N-phenylcyclohexene-1-carboxamide.
| Compound Name | 6-[2-(3,4-dimethoxyphenyl)ethylimino]-2-hydroxy-4,4-dimethyl-N-phenylcyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 135402306 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 6-[2-(3,4-dimethoxyphenyl)ethylimino]-2-hydroxy-4,4-dimethyl-N-phenylcyclohexene-1-carboxamide |
| SMILES | COc1ccc(CC/N=C2\CC(C)(C)CC(O)=C2C(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C25H30N2O4/c1-25(2)15-19(26-13-12-17-10-11-21(30-3)22(14-17)31-4)23(20(28)16-25)24(29)27-18-8-6-5-7-9-18/h5-11,14,28H,12-13,15-16H2,1-4H3,(H,27,29)/b26-19+ |
| InChIKey | UYGDLBUTAHTKNL-LGUFXXKBSA-N |
| XLogP | 4.96 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|