C26H29N3O4 — CID 42704104
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenyl-2-(phenylcarbamoylamino)propanamide (PubChem CID 42704104) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenyl-2-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenyl-2-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 42704104 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-phenyl-2-(phenylcarbamoylamino)propanamide |
| SMILES | COc1ccc(CCNC(=O)C(Cc2ccccc2)NC(=O)Nc2ccccc2)cc1OC |
| InChI | InChI=1S/C26H29N3O4/c1-32-23-14-13-20(18-24(23)33-2)15-16-27-25(30)22(17-19-9-5-3-6-10-19)29-26(31)28-21-11-7-4-8-12-21/h3-14,18,22H,15-17H2,1-2H3,(H,27,30)(H2,28,29,31) |
| InChIKey | NDMADMKNOCDHPW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |