C25H34N4O6 — CID 174508609
(2S)-2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-N-hydroxy-N'-phenyloctanediamide (PubChem CID 174508609) has the molecular formula C25H34N4O6 and a molecular weight of 486.57 g/mol. Its IUPAC name is (2S)-2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-N-hydroxy-N'-phenyloctanediamide.
| Compound Name | (2S)-2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-N-hydroxy-N'-phenyloctanediamide |
|---|---|
| PubChem CID | 174508609 |
| Molecular Formula | C25H34N4O6 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | (2S)-2-[2-(3,4-dimethoxyphenyl)ethylcarbamoylamino]-N-hydroxy-N'-phenyloctanediamide |
| SMILES | COc1ccc(CCNC(=O)N[C@@H](CCCCCC(=O)Nc2ccccc2)C(=O)NO)cc1OC |
| InChI | InChI=1S/C25H34N4O6/c1-34-21-14-13-18(17-22(21)35-2)15-16-26-25(32)28-20(24(31)29-33)11-7-4-8-12-23(30)27-19-9-5-3-6-10-19/h3,5-6,9-10,13-14,17,20,33H,4,7-8,11-12,15-16H2,1-2H3,(H,27,30)(H,29,31)(H2,26,28,32)/t20-/m0/s1 |
| InChIKey | RNEDIFJKGNKBJB-FQEVSTJZSA-N |
| XLogP | 3.01 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|