C25H23NO6 — CID 30688450
[2-(4-benzamidophenyl)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate (PubChem CID 30688450) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate.
| Compound Name | [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
|---|---|
| PubChem CID | 30688450 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [2-(4-benzamidophenyl)-2-oxoethyl] 2-(3,4-dimethoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCC(=O)c2ccc(NC(=O)c3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C25H23NO6/c1-30-22-13-8-17(14-23(22)31-2)15-24(28)32-16-21(27)18-9-11-20(12-10-18)26-25(29)19-6-4-3-5-7-19/h3-14H,15-16H2,1-2H3,(H,26,29) |
| InChIKey | CMPQLNUCNWHZHH-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |