C17H16N4OS — CID 135512181
N-[4-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide (PubChem CID 135512181) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is N-[4-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide.
| Compound Name | N-[4-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 135512181 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | N-[4-(2-phenylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C2=NN/C(=N/c3ccccc3)SC2)cc1 |
| InChI | InChI=1S/C17H16N4OS/c1-12(22)18-15-9-7-13(8-10-15)16-11-23-17(21-20-16)19-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,18,22)(H,19,21) |
| InChIKey | LTESMICVEPBGCT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|