C19H21ClN4OS — CID 135802474
N-[4-[2-(2,4-dimethylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]acetamide;hydrochloride (PubChem CID 135802474) has the molecular formula C19H21ClN4OS and a molecular weight of 388.92 g/mol. Its IUPAC name is N-[4-[2-(2,4-dimethylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]acetamide;hydrochloride.
| Compound Name | N-[4-[2-(2,4-dimethylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 135802474 |
| Molecular Formula | C19H21ClN4OS |
| Molecular Weight | 388.92 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | N-[4-[2-(2,4-dimethylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1ccc(C2=NN/C(=N/c3ccc(C)cc3C)SC2)cc1.Cl |
| InChI | InChI=1S/C19H20N4OS.ClH/c1-12-4-9-17(13(2)10-12)21-19-23-22-18(11-25-19)15-5-7-16(8-6-15)20-14(3)24;/h4-10H,11H2,1-3H3,(H,20,24)(H,21,23);1H |
| InChIKey | VXMHSUZYBDUYGG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.92 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|