C19H20N4OS — CID 135672885
N-[4-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]propanamide (PubChem CID 135672885) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is N-[4-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]propanamide.
| Compound Name | N-[4-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 135672885 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | N-[4-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C2=NN/C(=N/Cc3ccccc3)SC2)cc1 |
| InChI | InChI=1S/C19H20N4OS/c1-2-18(24)21-16-10-8-15(9-11-16)17-13-25-19(23-22-17)20-12-14-6-4-3-5-7-14/h3-11H,2,12-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | FYVFHFAIUIBUAH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|