C20H21ClN4OS — CID 135672849
N-[4-[2-(4-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]-3-methylbutanamide (PubChem CID 135672849) has the molecular formula C20H21ClN4OS and a molecular weight of 400.94 g/mol. Its IUPAC name is N-[4-[2-(4-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]-3-methylbutanamide.
| Compound Name | N-[4-[2-(4-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 135672849 |
| Molecular Formula | C20H21ClN4OS |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[4-[2-(4-chlorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C2=NN/C(=N/c3ccc(Cl)cc3)SC2)cc1 |
| InChI | InChI=1S/C20H21ClN4OS/c1-13(2)11-19(26)22-16-7-3-14(4-8-16)18-12-27-20(25-24-18)23-17-9-5-15(21)6-10-17/h3-10,13H,11-12H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | JLQZVFTXZAFHGE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|