C17H18N4O2S2 — CID 135623647
N-[4-[2-(4-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfonamide (PubChem CID 135623647) has the molecular formula C17H18N4O2S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[4-[2-(4-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[2-(4-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 135623647 |
| Molecular Formula | C17H18N4O2S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | N-[4-[2-(4-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]phenyl]methanesulfonamide |
| SMILES | Cc1ccc(/N=C2/NN=C(c3ccc(NS(C)(=O)=O)cc3)CS2)cc1 |
| InChI | InChI=1S/C17H18N4O2S2/c1-12-3-7-14(8-4-12)18-17-20-19-16(11-24-17)13-5-9-15(10-6-13)21-25(2,22)23/h3-10,21H,11H2,1-2H3,(H,18,20) |
| InChIKey | GWPWVJNSDSFVLZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|