C14H13N3OS — CID 135569723
5-(furan-2-yl)-N-(3-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135569723) has the molecular formula C14H13N3OS and a molecular weight of 271.35 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(3-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(furan-2-yl)-N-(3-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135569723 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 5-(furan-2-yl)-N-(3-methylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cccc(/N=C2/NN=C(c3ccco3)CS2)c1 |
| InChI | InChI=1S/C14H13N3OS/c1-10-4-2-5-11(8-10)15-14-17-16-12(9-19-14)13-6-3-7-18-13/h2-8H,9H2,1H3,(H,15,17) |
| InChIKey | YFQHEOZUDNSOPT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|