C17H16N4O2S — CID 135879160
2-hydroxy-5-[2-(3-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]benzamide (PubChem CID 135879160) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(3-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]benzamide.
| Compound Name | 2-hydroxy-5-[2-(3-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]benzamide |
|---|---|
| PubChem CID | 135879160 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 2-hydroxy-5-[2-(3-methylphenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]benzamide |
| SMILES | Cc1cccc(/N=C2/NN=C(c3ccc(O)c(C(N)=O)c3)CS2)c1 |
| InChI | InChI=1S/C17H16N4O2S/c1-10-3-2-4-12(7-10)19-17-21-20-14(9-24-17)11-5-6-15(22)13(8-11)16(18)23/h2-8,22H,9H2,1H3,(H2,18,23)(H,19,21) |
| InChIKey | QMNRCZCCMLRYSL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|