C18H15FN4OS — CID 135892371
5-[2-(2-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1-methyl-3H-indol-2-one (PubChem CID 135892371) has the molecular formula C18H15FN4OS and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[2-(2-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1-methyl-3H-indol-2-one.
| Compound Name | 5-[2-(2-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1-methyl-3H-indol-2-one |
|---|---|
| PubChem CID | 135892371 |
| Molecular Formula | C18H15FN4OS |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 5-[2-(2-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C3=NN/C(=N/c4ccccc4F)SC3)ccc21 |
| InChI | InChI=1S/C18H15FN4OS/c1-23-16-7-6-11(8-12(16)9-17(23)24)15-10-25-18(22-21-15)20-14-5-3-2-4-13(14)19/h2-8H,9-10H2,1H3,(H,20,22) |
| InChIKey | XGJHHIALTBVRLG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|