C17H13FN4OS — CID 158710675
6-[2-(4-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one (PubChem CID 158710675) has the molecular formula C17H13FN4OS and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-[2-(4-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one.
| Compound Name | 6-[2-(4-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 158710675 |
| Molecular Formula | C17H13FN4OS |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 6-[2-(4-fluorophenyl)imino-3,6-dihydro-1,3,4-thiadiazin-5-yl]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2ccc(C3=NN/C(=N/c4ccc(F)cc4)SC3)cc2N1 |
| InChI | InChI=1S/C17H13FN4OS/c18-12-3-5-13(6-4-12)19-17-22-21-15(9-24-17)10-1-2-11-8-16(23)20-14(11)7-10/h1-7H,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | IIRGBFIGXMNWBD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|