C15H9Cl2F2N3S — CID 135774952
5-(3,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135774952) has the molecular formula C15H9Cl2F2N3S and a molecular weight of 372.23 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135774952 |
| Molecular Formula | C15H9Cl2F2N3S |
| Molecular Weight | 372.23 g/mol |
| Exact Mass | 370.99 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(2,4-difluorophenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Fc1ccc(/N=C2/NN=C(c3ccc(Cl)c(Cl)c3)CS2)c(F)c1 |
| InChI | InChI=1S/C15H9Cl2F2N3S/c16-10-3-1-8(5-11(10)17)14-7-23-15(22-21-14)20-13-4-2-9(18)6-12(13)19/h1-6H,7H2,(H,20,22) |
| InChIKey | OPOZUCBCJGGGCW-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.23 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|