C14H11Cl2N3S2 — CID 135794929
N-(2,4-dichlorophenyl)-5-(5-methylthiophen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135794929) has the molecular formula C14H11Cl2N3S2 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-(5-methylthiophen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2,4-dichlorophenyl)-5-(5-methylthiophen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135794929 |
| Molecular Formula | C14H11Cl2N3S2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-(5-methylthiophen-2-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1ccc(C2=NN/C(=N/c3ccc(Cl)cc3Cl)SC2)s1 |
| InChI | InChI=1S/C14H11Cl2N3S2/c1-8-2-5-13(21-8)12-7-20-14(19-18-12)17-11-4-3-9(15)6-10(11)16/h2-6H,7H2,1H3,(H,17,19) |
| InChIKey | ODYRDFQHIMEVGY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|