C19H20Cl2N4O2S2 — CID 135954950
N-(2,4-dichlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135954950) has the molecular formula C19H20Cl2N4O2S2 and a molecular weight of 471.44 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2,4-dichlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135954950 |
| Molecular Formula | C19H20Cl2N4O2S2 |
| Molecular Weight | 471.44 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | N-(2,4-dichlorophenyl)-5-[1-(1,1-dioxothiolan-3-yl)-2,5-dimethylpyrrol-3-yl]-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1cc(C2=NN/C(=N/c3ccc(Cl)cc3Cl)SC2)c(C)n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H20Cl2N4O2S2/c1-11-7-15(12(2)25(11)14-5-6-29(26,27)10-14)18-9-28-19(24-23-18)22-17-4-3-13(20)8-16(17)21/h3-4,7-8,14H,5-6,9-10H2,1-2H3,(H,22,24) |
| InChIKey | AMIZHRSPVHDDEA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.44 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|