C21H26ClN5O3S2 — CID 135840292
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135840292) has the molecular formula C21H26ClN5O3S2 and a molecular weight of 496.06 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135840292 |
| Molecular Formula | C21H26ClN5O3S2 |
| Molecular Weight | 496.06 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-5-(1-ethyl-2,5-dimethylpyrrol-3-yl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | CCn1c(C)cc(C2=NN/C(=N/c3cc(S(=O)(=O)N4CCOCC4)ccc3Cl)SC2)c1C |
| InChI | InChI=1S/C21H26ClN5O3S2/c1-4-27-14(2)11-17(15(27)3)20-13-31-21(25-24-20)23-19-12-16(5-6-18(19)22)32(28,29)26-7-9-30-10-8-26/h5-6,11-12H,4,7-10,13H2,1-3H3,(H,23,25) |
| InChIKey | ROTYBXKPOUAGNY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.06 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|