C26H29N5O4S2 — CID 135498317
5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-morpholin-4-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135498317) has the molecular formula C26H29N5O4S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-morpholin-4-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-morpholin-4-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135498317 |
| Molecular Formula | C26H29N5O4S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 5-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-N-(4-morpholin-4-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | COc1ccc(-n2c(C)cc(C3=NN/C(=N/c4ccc(S(=O)(=O)N5CCOCC5)cc4)SC3)c2C)cc1 |
| InChI | InChI=1S/C26H29N5O4S2/c1-18-16-24(19(2)31(18)21-6-8-22(34-3)9-7-21)25-17-36-26(29-28-25)27-20-4-10-23(11-5-20)37(32,33)30-12-14-35-15-13-30/h4-11,16H,12-15,17H2,1-3H3,(H,27,29) |
| InChIKey | RDUFLLBVUIUFDG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|