C28H35N3O5S2 — CID 23827955
3-cycloheptyl-4-(2,5-dimethoxyphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine (PubChem CID 23827955) has the molecular formula C28H35N3O5S2 and a molecular weight of 557.74 g/mol. Its IUPAC name is 3-cycloheptyl-4-(2,5-dimethoxyphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine.
| Compound Name | 3-cycloheptyl-4-(2,5-dimethoxyphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23827955 |
| Molecular Formula | C28H35N3O5S2 |
| Molecular Weight | 557.74 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 3-cycloheptyl-4-(2,5-dimethoxyphenyl)-N-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-imine |
| SMILES | COc1ccc(OC)c(-c2cs/c(=N\c3ccc(S(=O)(=O)N4CCOCC4)cc3)n2C2CCCCCC2)c1 |
| InChI | InChI=1S/C28H35N3O5S2/c1-34-23-11-14-27(35-2)25(19-23)26-20-37-28(31(26)22-7-5-3-4-6-8-22)29-21-9-12-24(13-10-21)38(32,33)30-15-17-36-18-16-30/h9-14,19-20,22H,3-8,15-18H2,1-2H3/b29-28- |
| InChIKey | SNMSKQMHCIZROO-ZIADKAODSA-N |
| XLogP | 5.38 |
| TPSA | 82.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|