C21H24N4O2S2 — CID 135555648
N-(4-methylphenyl)-5-(4-piperidin-1-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine (PubChem CID 135555648) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(4-methylphenyl)-5-(4-piperidin-1-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine.
| Compound Name | N-(4-methylphenyl)-5-(4-piperidin-1-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 135555648 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | N-(4-methylphenyl)-5-(4-piperidin-1-ylsulfonylphenyl)-3,6-dihydro-1,3,4-thiadiazin-2-imine |
| SMILES | Cc1ccc(/N=C2/NN=C(c3ccc(S(=O)(=O)N4CCCCC4)cc3)CS2)cc1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-16-5-9-18(10-6-16)22-21-24-23-20(15-28-21)17-7-11-19(12-8-17)29(26,27)25-13-3-2-4-14-25/h5-12H,2-4,13-15H2,1H3,(H,22,24) |
| InChIKey | SSDNWODDSSBTHY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_urea_L(1)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|