C27H27Cl2N3O4S — CID 6239507
(3Z)-3-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 6239507) has the molecular formula C27H27Cl2N3O4S and a molecular weight of 560.50 g/mol. Its IUPAC name is (3Z)-3-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | (3Z)-3-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 6239507 |
| Molecular Formula | C27H27Cl2N3O4S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 559.11 |
| IUPAC Name | (3Z)-3-[[1-(3,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(C)n(-c3ccc(Cl)c(Cl)c3)c2C)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C27H27Cl2N3O4S/c1-4-31-26-8-6-21(37(34,35)30-9-11-36-12-10-30)16-22(26)23(27(31)33)14-19-13-17(2)32(18(19)3)20-5-7-24(28)25(29)15-20/h5-8,13-16H,4,9-12H2,1-3H3/b23-14- |
| InChIKey | WWRUSTDIAPBKBH-UCQKPKSFSA-N |
| XLogP | 5.33 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|