C33H39N3O4S — CID 6239511
(3Z)-3-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 6239511) has the molecular formula C33H39N3O4S and a molecular weight of 573.76 g/mol. Its IUPAC name is (3Z)-3-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | (3Z)-3-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 6239511 |
| Molecular Formula | C33H39N3O4S |
| Molecular Weight | 573.76 g/mol |
| Exact Mass | 573.27 |
| IUPAC Name | (3Z)-3-[[1-(4-cyclohexylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(C)n(-c3ccc(C4CCCCC4)cc3)c2C)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C33H39N3O4S/c1-4-35-32-15-14-29(41(38,39)34-16-18-40-19-17-34)22-30(32)31(33(35)37)21-27-20-23(2)36(24(27)3)28-12-10-26(11-13-28)25-8-6-5-7-9-25/h10-15,20-22,25H,4-9,16-19H2,1-3H3/b31-21- |
| InChIKey | CHVKPVZLGIPGLF-YQYKVWLJSA-N |
| XLogP | 6.07 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.76 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|