C30H33N5O6S — CID 4979839
3-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979839) has the molecular formula C30H33N5O6S and a molecular weight of 591.69 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 3-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979839 |
| Molecular Formula | C30H33N5O6S |
| Molecular Weight | 591.69 g/mol |
| Exact Mass | 591.22 |
| IUPAC Name | 3-[[2,5-dimethyl-1-(3-nitro-4-pyrrolidin-1-ylphenyl)pyrrol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | Cc1cc(C=C2C(=O)N(C)c3ccc(S(=O)(=O)N4CCOCC4)cc32)c(C)n1-c1ccc(N2CCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H33N5O6S/c1-20-16-22(21(2)34(20)23-6-8-28(29(18-23)35(37)38)32-10-4-5-11-32)17-26-25-19-24(7-9-27(25)31(3)30(26)36)42(39,40)33-12-14-41-15-13-33/h6-9,16-19H,4-5,10-15H2,1-3H3 |
| InChIKey | XPZSYROVXJLAIQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 118.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|