C28H30BrN3O4S — CID 6239522
(3Z)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 6239522) has the molecular formula C28H30BrN3O4S and a molecular weight of 584.54 g/mol. Its IUPAC name is (3Z)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | (3Z)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 6239522 |
| Molecular Formula | C28H30BrN3O4S |
| Molecular Weight | 584.54 g/mol |
| Exact Mass | 583.11 |
| IUPAC Name | (3Z)-3-[[1-(4-bromo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-1-ethyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(C)n(-c3ccc(Br)c(C)c3)c2C)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C28H30BrN3O4S/c1-5-31-27-9-7-23(37(34,35)30-10-12-36-13-11-30)17-24(27)25(28(31)33)16-21-15-19(3)32(20(21)4)22-6-8-26(29)18(2)14-22/h6-9,14-17H,5,10-13H2,1-4H3/b25-16- |
| InChIKey | GWOUSUNHEXVTCH-XYGWBWBKSA-N |
| XLogP | 5.09 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|