C29H34N4O5S — CID 6239449
N,N-diethyl-2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]acetamide (PubChem CID 6239449) has the molecular formula C29H34N4O5S and a molecular weight of 550.68 g/mol. Its IUPAC name is N,N-diethyl-2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]acetamide |
|---|---|
| PubChem CID | 6239449 |
| Molecular Formula | C29H34N4O5S |
| Molecular Weight | 550.68 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N,N-diethyl-2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cn1cc(/C=C2\C(=O)N(CC)c3ccc(S(=O)(=O)N4CCOCC4)cc32)c2ccccc21 |
| InChI | InChI=1S/C29H34N4O5S/c1-4-30(5-2)28(34)20-31-19-21(23-9-7-8-10-26(23)31)17-25-24-18-22(11-12-27(24)33(6-3)29(25)35)39(36,37)32-13-15-38-16-14-32/h7-12,17-19H,4-6,13-16,20H2,1-3H3/b25-17- |
| InChIKey | JBNHLQGEFULFFI-UQQQWYQISA-N |
| XLogP | 3.44 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|