C28H32N4O6S — CID 6239425
2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 6239425) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is 2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 6239425 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 2-[3-[(Z)-(1-ethyl-5-morpholin-4-ylsulfonyl-2-oxoindol-3-ylidene)methyl]indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN1C(=O)/C(=C\c2cn(CC(=O)NCCOC)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C28H32N4O6S/c1-3-32-26-9-8-21(39(35,36)31-11-14-38-15-12-31)17-23(26)24(28(32)34)16-20-18-30(19-27(33)29-10-13-37-2)25-7-5-4-6-22(20)25/h4-9,16-18H,3,10-15,19H2,1-2H3,(H,29,33)/b24-16- |
| InChIKey | RWPIMFXAWTXCDQ-JLPGSUDCSA-N |
| XLogP | 2.33 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|