C29H32N4O5S — CID 6239417
(3Z)-1-methyl-5-morpholin-4-ylsulfonyl-3-[[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]indol-2-one (PubChem CID 6239417) has the molecular formula C29H32N4O5S and a molecular weight of 548.67 g/mol. Its IUPAC name is (3Z)-1-methyl-5-morpholin-4-ylsulfonyl-3-[[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]indol-2-one.
| Compound Name | (3Z)-1-methyl-5-morpholin-4-ylsulfonyl-3-[[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]indol-2-one |
|---|---|
| PubChem CID | 6239417 |
| Molecular Formula | C29H32N4O5S |
| Molecular Weight | 548.67 g/mol |
| Exact Mass | 548.21 |
| IUPAC Name | (3Z)-1-methyl-5-morpholin-4-ylsulfonyl-3-[[1-(2-oxo-2-piperidin-1-ylethyl)indol-3-yl]methylidene]indol-2-one |
| SMILES | CN1C(=O)/C(=C\c2cn(CC(=O)N3CCCCC3)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C29H32N4O5S/c1-30-26-10-9-22(39(36,37)33-13-15-38-16-14-33)18-24(26)25(29(30)35)17-21-19-32(27-8-4-3-7-23(21)27)20-28(34)31-11-5-2-6-12-31/h3-4,7-10,17-19H,2,5-6,11-16,20H2,1H3/b25-17- |
| InChIKey | GXHMLMBWVRVEHY-UQQQWYQISA-N |
| XLogP | 3.19 |
| TPSA | 92.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|