C26H29N3O5S — CID 6239459
(3Z)-1-ethyl-3-[[1-(2-methoxyethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 6239459) has the molecular formula C26H29N3O5S and a molecular weight of 495.60 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-[[1-(2-methoxyethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | (3Z)-1-ethyl-3-[[1-(2-methoxyethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 6239459 |
| Molecular Formula | C26H29N3O5S |
| Molecular Weight | 495.60 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (3Z)-1-ethyl-3-[[1-(2-methoxyethyl)indol-3-yl]methylidene]-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cn(CCOC)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C26H29N3O5S/c1-3-29-25-9-8-20(35(31,32)28-11-14-34-15-12-28)17-22(25)23(26(29)30)16-19-18-27(10-13-33-2)24-7-5-4-6-21(19)24/h4-9,16-18H,3,10-15H2,1-2H3/b23-16- |
| InChIKey | ZPVFYDFGSHTULK-KQWNVCNZSA-N |
| XLogP | 3.22 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|