C29H26FN3O4S — CID 4979494
3-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one (PubChem CID 4979494) has the molecular formula C29H26FN3O4S and a molecular weight of 531.61 g/mol. Its IUPAC name is 3-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one.
| Compound Name | 3-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
|---|---|
| PubChem CID | 4979494 |
| Molecular Formula | C29H26FN3O4S |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 3-[[1-[(4-fluorophenyl)methyl]indol-3-yl]methylidene]-1-methyl-5-morpholin-4-ylsulfonylindol-2-one |
| SMILES | CN1C(=O)C(=Cc2cn(Cc3ccc(F)cc3)c3ccccc23)c2cc(S(=O)(=O)N3CCOCC3)ccc21 |
| InChI | InChI=1S/C29H26FN3O4S/c1-31-27-11-10-23(38(35,36)33-12-14-37-15-13-33)17-25(27)26(29(31)34)16-21-19-32(28-5-3-2-4-24(21)28)18-20-6-8-22(30)9-7-20/h2-11,16-17,19H,12-15,18H2,1H3 |
| InChIKey | UHYTWPWTCOBPCO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|