C25H20N2O — CID 5293756
(3Z)-3-[(1-benzylindol-3-yl)methylidene]-1-methylindol-2-one (PubChem CID 5293756) has the molecular formula C25H20N2O and a molecular weight of 364.45 g/mol. Its IUPAC name is (3Z)-3-[(1-benzylindol-3-yl)methylidene]-1-methylindol-2-one.
| Compound Name | (3Z)-3-[(1-benzylindol-3-yl)methylidene]-1-methylindol-2-one |
|---|---|
| PubChem CID | 5293756 |
| Molecular Formula | C25H20N2O |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | (3Z)-3-[(1-benzylindol-3-yl)methylidene]-1-methylindol-2-one |
| SMILES | CN1C(=O)/C(=C\c2cn(Cc3ccccc3)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C25H20N2O/c1-26-23-13-7-6-12-21(23)22(25(26)28)15-19-17-27(16-18-9-3-2-4-10-18)24-14-8-5-11-20(19)24/h2-15,17H,16H2,1H3/b22-15- |
| InChIKey | BVIVSPJJXCYFTK-JCMHNJIXSA-N |
| XLogP | 5.21 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|