C26H17Cl2N3O3 — CID 126074920
(5E)-5-[(1-benzylindol-3-yl)methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 126074920) has the molecular formula C26H17Cl2N3O3 and a molecular weight of 490.35 g/mol. Its IUPAC name is (5E)-5-[(1-benzylindol-3-yl)methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(1-benzylindol-3-yl)methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 126074920 |
| Molecular Formula | C26H17Cl2N3O3 |
| Molecular Weight | 490.35 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | (5E)-5-[(1-benzylindol-3-yl)methylidene]-1-(2,3-dichlorophenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2Cl)C(=O)/C1=C/c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H17Cl2N3O3/c27-20-10-6-12-22(23(20)28)31-25(33)19(24(32)29-26(31)34)13-17-15-30(14-16-7-2-1-3-8-16)21-11-5-4-9-18(17)21/h1-13,15H,14H2,(H,29,32,34)/b19-13+ |
| InChIKey | TVCXXPQFTBCIDW-CPNJWEJPSA-N |
| XLogP | 5.66 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|