C27H16Cl2N4O3 — CID 126102515
2-[[3-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126102515) has the molecular formula C27H16Cl2N4O3 and a molecular weight of 515.36 g/mol. Its IUPAC name is 2-[[3-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126102515 |
| Molecular Formula | C27H16Cl2N4O3 |
| Molecular Weight | 515.36 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 2-[[3-[(E)-[1-(2,3-dichlorophenyl)-2,4,6-trioxo-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1Cn1cc(/C=C2\C(=O)NC(=O)N(c3cccc(Cl)c3Cl)C2=O)c2ccccc21 |
| InChI | InChI=1S/C27H16Cl2N4O3/c28-21-9-5-11-23(24(21)29)33-26(35)20(25(34)31-27(33)36)12-18-15-32(22-10-4-3-8-19(18)22)14-17-7-2-1-6-16(17)13-30/h1-12,15H,14H2,(H,31,34,36)/b20-12+ |
| InChIKey | JAYQQISEPDITJX-UDWIEESQSA-N |
| XLogP | 5.53 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|