C30H24N4O2S — CID 126240834
2-[[3-[(E)-[4,6-dioxo-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile (PubChem CID 126240834) has the molecular formula C30H24N4O2S and a molecular weight of 504.62 g/mol. Its IUPAC name is 2-[[3-[(E)-[4,6-dioxo-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile.
| Compound Name | 2-[[3-[(E)-[4,6-dioxo-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 126240834 |
| Molecular Formula | C30H24N4O2S |
| Molecular Weight | 504.62 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[[3-[(E)-[4,6-dioxo-1-(4-propan-2-ylphenyl)-2-sulfanylidene-1,3-diazinan-5-ylidene]methyl]indol-1-yl]methyl]benzonitrile |
| SMILES | CC(C)c1ccc(N2C(=O)/C(=C/c3cn(Cc4ccccc4C#N)c4ccccc34)C(=O)NC2=S)cc1 |
| InChI | InChI=1S/C30H24N4O2S/c1-19(2)20-11-13-24(14-12-20)34-29(36)26(28(35)32-30(34)37)15-23-18-33(27-10-6-5-9-25(23)27)17-22-8-4-3-7-21(22)16-31/h3-15,18-19H,17H2,1-2H3,(H,32,35,37)/b26-15+ |
| InChIKey | OIHKECLNSXODLV-CVKSISIWSA-N |
| XLogP | 5.52 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|