C30H19BrCl2N2O — CID 155811181
(3Z)-3-[(1-benzyl-5-bromoindol-3-yl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one (PubChem CID 155811181) has the molecular formula C30H19BrCl2N2O and a molecular weight of 574.31 g/mol. Its IUPAC name is (3Z)-3-[(1-benzyl-5-bromoindol-3-yl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one.
| Compound Name | (3Z)-3-[(1-benzyl-5-bromoindol-3-yl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one |
|---|---|
| PubChem CID | 155811181 |
| Molecular Formula | C30H19BrCl2N2O |
| Molecular Weight | 574.31 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | (3Z)-3-[(1-benzyl-5-bromoindol-3-yl)methylidene]-1-(2,6-dichlorophenyl)indol-2-one |
| SMILES | O=C1/C(=C\c2cn(Cc3ccccc3)c3ccc(Br)cc23)c2ccccc2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C30H19BrCl2N2O/c31-21-13-14-27-23(16-21)20(18-34(27)17-19-7-2-1-3-8-19)15-24-22-9-4-5-12-28(22)35(30(24)36)29-25(32)10-6-11-26(29)33/h1-16,18H,17H2/b24-15- |
| InChIKey | FFFYFOCBTSTVPH-IWIPYMOSSA-N |
| XLogP | 8.98 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.31 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_L(4)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|