C21H11Cl4NO — CID 42600229
(3Z)-1-(2,6-dichlorophenyl)-3-[(2,4-dichlorophenyl)methylidene]indol-2-one (PubChem CID 42600229) has the molecular formula C21H11Cl4NO and a molecular weight of 435.14 g/mol. Its IUPAC name is (3Z)-1-(2,6-dichlorophenyl)-3-[(2,4-dichlorophenyl)methylidene]indol-2-one.
| Compound Name | (3Z)-1-(2,6-dichlorophenyl)-3-[(2,4-dichlorophenyl)methylidene]indol-2-one |
|---|---|
| PubChem CID | 42600229 |
| Molecular Formula | C21H11Cl4NO |
| Molecular Weight | 435.14 g/mol |
| Exact Mass | 432.96 |
| IUPAC Name | (3Z)-1-(2,6-dichlorophenyl)-3-[(2,4-dichlorophenyl)methylidene]indol-2-one |
| SMILES | O=C1/C(=C\c2ccc(Cl)cc2Cl)c2ccccc2N1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H11Cl4NO/c22-13-9-8-12(18(25)11-13)10-15-14-4-1-2-7-19(14)26(21(15)27)20-16(23)5-3-6-17(20)24/h1-11H/b15-10- |
| InChIKey | GBLUZQALHCGHIR-GDNBJRDFSA-N |
| XLogP | 7.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.14 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|