C20H11Cl2NO2 — CID 4270109
4-[(2,4-dichlorophenyl)methylidene]-3-naphthalen-1-yl-1,2-oxazol-5-one (PubChem CID 4270109) has the molecular formula C20H11Cl2NO2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 4-[(2,4-dichlorophenyl)methylidene]-3-naphthalen-1-yl-1,2-oxazol-5-one.
| Compound Name | 4-[(2,4-dichlorophenyl)methylidene]-3-naphthalen-1-yl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 4270109 |
| Molecular Formula | C20H11Cl2NO2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 4-[(2,4-dichlorophenyl)methylidene]-3-naphthalen-1-yl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2cccc3ccccc23)C1=Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H11Cl2NO2/c21-14-9-8-13(18(22)11-14)10-17-19(23-25-20(17)24)16-7-3-5-12-4-1-2-6-15(12)16/h1-11H |
| InChIKey | IKPKFWPRZGXYTM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|