C20H11Cl2NO3 — CID 2301381
(4E)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 2301381) has the molecular formula C20H11Cl2NO3 and a molecular weight of 384.22 g/mol. Its IUPAC name is (4E)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 2301381 |
| Molecular Formula | C20H11Cl2NO3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | (4E)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C20H11Cl2NO3/c21-13-6-8-15(17(22)10-13)18-9-7-14(25-18)11-16-19(23-26-20(16)24)12-4-2-1-3-5-12/h1-11H/b16-11+ |
| InChIKey | ZIMQJDHREDVGTK-LFIBNONCSA-N |
| XLogP | 5.60 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|