C23H13Br2Cl2NO3 — CID 126092910
(4Z)-4-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 126092910) has the molecular formula C23H13Br2Cl2NO3 and a molecular weight of 582.08 g/mol. Its IUPAC name is (4Z)-4-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 126092910 |
| Molecular Formula | C23H13Br2Cl2NO3 |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 578.86 |
| IUPAC Name | (4Z)-4-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)/C1=C/c1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C23H13Br2Cl2NO3/c24-16-8-15(9-18-21(28-31-23(18)29)13-4-2-1-3-5-13)22(19(25)10-16)30-12-14-6-7-17(26)11-20(14)27/h1-11H,12H2/b18-9- |
| InChIKey | QXFUEBJIXLGAIL-NVMNQCDNSA-N |
| XLogP | 7.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|