C18H10Br2Cl2N2O3S — CID 126047615
5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 126047615) has the molecular formula C18H10Br2Cl2N2O3S and a molecular weight of 565.07 g/mol. Its IUPAC name is 5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 126047615 |
| Molecular Formula | C18H10Br2Cl2N2O3S |
| Molecular Weight | 565.07 g/mol |
| Exact Mass | 561.82 |
| IUPAC Name | 5-[[3,5-dibromo-2-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1cc(Br)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H10Br2Cl2N2O3S/c19-10-3-9(4-12-16(25)23-18(28)24-17(12)26)15(13(20)5-10)27-7-8-1-2-11(21)6-14(8)22/h1-6H,7H2,(H2,23,24,25,26,28) |
| InChIKey | JAZZEVRNDTXZLD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.07 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|