C24H17ClFNO4 — CID 126083942
(4Z)-4-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 126083942) has the molecular formula C24H17ClFNO4 and a molecular weight of 437.85 g/mol. Its IUPAC name is (4Z)-4-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | (4Z)-4-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 126083942 |
| Molecular Formula | C24H17ClFNO4 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (4Z)-4-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | COc1cc(/C=C2\C(=O)ON=C2c2ccccc2)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C24H17ClFNO4/c1-29-21-13-15(11-18-22(27-31-24(18)28)16-7-3-2-4-8-16)12-19(25)23(21)30-14-17-9-5-6-10-20(17)26/h2-13H,14H2,1H3/b18-11- |
| InChIKey | FZMZGRXNXMOGRS-WQRHYEAKSA-N |
| XLogP | 5.41 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|