C21H9Cl2F5N2O2 — CID 126045649
(4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one (PubChem CID 126045649) has the molecular formula C21H9Cl2F5N2O2 and a molecular weight of 487.21 g/mol. Its IUPAC name is (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
|---|---|
| PubChem CID | 126045649 |
| Molecular Formula | C21H9Cl2F5N2O2 |
| Molecular Weight | 487.21 g/mol |
| Exact Mass | 486.00 |
| IUPAC Name | (4Z)-4-[[5-(2,4-dichlorophenyl)furan-2-yl]methylidene]-5-methyl-2-(2,3,4,5,6-pentafluorophenyl)pyrazol-3-one |
| SMILES | CC1=NN(c2c(F)c(F)c(F)c(F)c2F)C(=O)/C1=C\c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H9Cl2F5N2O2/c1-8-12(7-10-3-5-14(32-10)11-4-2-9(22)6-13(11)23)21(31)30(29-8)20-18(27)16(25)15(24)17(26)19(20)28/h2-7H,1H3/b12-7- |
| InChIKey | QXAWPSSNUZZHAC-GHXNOFRVSA-N |
| XLogP | 6.76 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.21 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|