C24H15F5N2O4 — CID 126042416
methyl 4-methyl-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126042416) has the molecular formula C24H15F5N2O4 and a molecular weight of 490.38 g/mol. Its IUPAC name is methyl 4-methyl-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-methyl-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126042416 |
| Molecular Formula | C24H15F5N2O4 |
| Molecular Weight | 490.38 g/mol |
| Exact Mass | 490.10 |
| IUPAC Name | methyl 4-methyl-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C)c(-c2ccc(/C=C3/C(=O)N(c4c(F)c(F)c(F)c(F)c4F)N=C3C)o2)c1 |
| InChI | InChI=1S/C24H15F5N2O4/c1-10-4-5-12(24(33)34-3)8-14(10)16-7-6-13(35-16)9-15-11(2)30-31(23(15)32)22-20(28)18(26)17(25)19(27)21(22)29/h4-9H,1-3H3/b15-9+ |
| InChIKey | RBOSXGZYFSMNOB-OQLLNIDSSA-N |
| XLogP | 5.54 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|