C25H20FN3O6 — CID 126219256
methyl 3-[5-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]-4-methylbenzoate (PubChem CID 126219256) has the molecular formula C25H20FN3O6 and a molecular weight of 477.45 g/mol. Its IUPAC name is methyl 3-[5-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]-4-methylbenzoate.
| Compound Name | methyl 3-[5-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]-4-methylbenzoate |
|---|---|
| PubChem CID | 126219256 |
| Molecular Formula | C25H20FN3O6 |
| Molecular Weight | 477.45 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | methyl 3-[5-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]furan-2-yl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(-c2ccc(/C=C3/NC(=O)N(CC(=O)Nc4ccccc4F)C3=O)o2)c1 |
| InChI | InChI=1S/C25H20FN3O6/c1-14-7-8-15(24(32)34-2)11-17(14)21-10-9-16(35-21)12-20-23(31)29(25(33)28-20)13-22(30)27-19-6-4-3-5-18(19)26/h3-12H,13H2,1-2H3,(H,27,30)(H,28,33)/b20-12+ |
| InChIKey | SARXYEFJSOTZKH-UDWIEESQSA-N |
| XLogP | 3.71 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|