C23H12ClF5N2O4 — CID 126037588
methyl 4-chloro-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126037588) has the molecular formula C23H12ClF5N2O4 and a molecular weight of 510.80 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126037588 |
| Molecular Formula | C23H12ClF5N2O4 |
| Molecular Weight | 510.80 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | methyl 4-chloro-3-[5-[(E)-[3-methyl-5-oxo-1-(2,3,4,5,6-pentafluorophenyl)pyrazol-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(-c2ccc(/C=C3/C(=O)N(c4c(F)c(F)c(F)c(F)c4F)N=C3C)o2)c1 |
| InChI | InChI=1S/C23H12ClF5N2O4/c1-9-12(22(32)31(30-9)21-19(28)17(26)16(25)18(27)20(21)29)8-11-4-6-15(35-11)13-7-10(23(33)34-2)3-5-14(13)24/h3-8H,1-2H3/b12-8+ |
| InChIKey | JBZLHNKIQOGHNK-XYOKQWHBSA-N |
| XLogP | 5.89 |
| TPSA | 72.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.80 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|