C29H19ClN2O6 — CID 126007986
methyl 4-chloro-3-[5-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 126007986) has the molecular formula C29H19ClN2O6 and a molecular weight of 526.93 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-chloro-3-[5-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126007986 |
| Molecular Formula | C29H19ClN2O6 |
| Molecular Weight | 526.93 g/mol |
| Exact Mass | 526.09 |
| IUPAC Name | methyl 4-chloro-3-[5-[(2,4,6-trioxo-1,3-diphenyl-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(-c2ccc(C=C3C(=O)N(c4ccccc4)C(=O)N(c4ccccc4)C3=O)o2)c1 |
| InChI | InChI=1S/C29H19ClN2O6/c1-37-28(35)18-12-14-24(30)22(16-18)25-15-13-21(38-25)17-23-26(33)31(19-8-4-2-5-9-19)29(36)32(27(23)34)20-10-6-3-7-11-20/h2-17H,1H3 |
| InChIKey | PMXFQQUCKBHHIA-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.93 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|