C26H22N2O7 — CID 126023993
methyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 126023993) has the molecular formula C26H22N2O7 and a molecular weight of 474.47 g/mol. Its IUPAC name is methyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126023993 |
| Molecular Formula | C26H22N2O7 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | methyl 4-[5-[(Z)-[1-(2-methoxyethyl)-2,4,6-trioxo-3-phenyl-1,3-diazinan-5-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | COCCN1C(=O)/C(=C/c2ccc(-c3ccc(C(=O)OC)cc3)o2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C26H22N2O7/c1-33-15-14-27-23(29)21(24(30)28(26(27)32)19-6-4-3-5-7-19)16-20-12-13-22(35-20)17-8-10-18(11-9-17)25(31)34-2/h3-13,16H,14-15H2,1-2H3/b21-16- |
| InChIKey | ZHHLUCZTWKAKAX-PGMHBOJBSA-N |
| XLogP | 3.76 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|