C25H20N2O7 — CID 1007557
ethyl 4-[5-[(Z)-[1-(4-methoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate (PubChem CID 1007557) has the molecular formula C25H20N2O7 and a molecular weight of 460.44 g/mol. Its IUPAC name is ethyl 4-[5-[(Z)-[1-(4-methoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(Z)-[1-(4-methoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 1007557 |
| Molecular Formula | C25H20N2O7 |
| Molecular Weight | 460.44 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethyl 4-[5-[(Z)-[1-(4-methoxycarbonylphenyl)-3,5-dioxopyrazolidin-4-ylidene]methyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C3/C(=O)NN(c4ccc(C(=O)OC)cc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C25H20N2O7/c1-3-33-25(31)17-6-4-15(5-7-17)21-13-12-19(34-21)14-20-22(28)26-27(23(20)29)18-10-8-16(9-11-18)24(30)32-2/h4-14H,3H2,1-2H3,(H,26,28)/b20-14- |
| InChIKey | LHIVFNJSCXAQGD-ZHZULCJRSA-N |
| XLogP | 3.37 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|